C26H19NO5 — CID 12523204
dimethyl 1-benzoyl-6H-indeno[1,2-e]indolizine-2,3-dicarboxylate (PubChem CID 12523204) has the molecular formula C26H19NO5 and a molecular weight of 425.44 g/mol. Its IUPAC name is dimethyl 1-benzoyl-6H-indeno[1,2-e]indolizine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-benzoyl-6H-indeno[1,2-e]indolizine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 12523204 |
| Molecular Formula | C26H19NO5 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | dimethyl 1-benzoyl-6H-indeno[1,2-e]indolizine-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2ccc3c(n2c1C(=O)c1ccccc1)-c1ccccc1C3 |
| InChI | InChI=1S/C26H19NO5/c1-31-25(29)20-19-13-12-17-14-16-10-6-7-11-18(16)22(17)27(19)23(21(20)26(30)32-2)24(28)15-8-4-3-5-9-15/h3-13H,14H2,1-2H3 |
| InChIKey | PLAVWSGOLLEHFU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |