About dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate
dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate (PubChem CID 102386187) has the molecular formula C28H23NO5
and a molecular weight of 453.49 g/mol. Its IUPAC name is dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate |
| PubChem CID | 102386187 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(-c2ccccc2)n(Cc2ccccc2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23NO5/c1-33-27(31)22-23(28(32)34-2)25(26(30)21-16-10-5-11-17-21)29(18-19-12-6-3-7-13-19)24(22)20-14-8-4-9-15-20/h3-17H,18H2,1-2H3 |
| InChIKey | QFKCEFCIVHUHRC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate?
The IUPAC name of dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate (CID 102386187) is dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate.
What is the SMILES notation for dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate?
The canonical SMILES for dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate is COC(=O)c1c(C(=O)OC)c(-c2ccccc2)n(Cc2ccccc2)c1C(=O)c1ccccc1.
What is the InChIKey of dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate?
The InChIKey is QFKCEFCIVHUHRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23NO5/c1-33-27(31)22-23(28(32)34-2)25(26(30)21-16-10-5-11-17-21)29(18-19-12-6-3-7-13-19)24(22)20-14-8-4-9-15-20/h3-17H,18H2,1-2H3.
What are the key properties of dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate?
dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate has a molecular weight of 453.49 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-benzoyl-1-benzyl-5-phenylpyrrole-3,4-dicarboxylate is sourced from PubChem (CID 102386187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).