C28H27NO6 — CID 10504659
dimethyl 2,5-dibenzoyl-1-cyclohexylpyrrole-3,4-dicarboxylate (PubChem CID 10504659) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is dimethyl 2,5-dibenzoyl-1-cyclohexylpyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 2,5-dibenzoyl-1-cyclohexylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10504659 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | dimethyl 2,5-dibenzoyl-1-cyclohexylpyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(C(=O)c2ccccc2)n(C2CCCCC2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H27NO6/c1-34-27(32)21-22(28(33)35-2)24(26(31)19-14-8-4-9-15-19)29(20-16-10-5-11-17-20)23(21)25(30)18-12-6-3-7-13-18/h3-4,6-9,12-15,20H,5,10-11,16-17H2,1-2H3 |
| InChIKey | NEKWLDRQROPJGJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |