C18H23NO3 — CID 10566210
methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate (PubChem CID 10566210) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate.
| Compound Name | methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate |
|---|---|
| PubChem CID | 10566210 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate |
| SMILES | COC(=O)/C1=C/CCCCCC[C@@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO3/c1-22-18(21)15-12-8-3-2-4-9-13-16(15)19-17(20)14-10-6-5-7-11-14/h5-7,10-12,16H,2-4,8-9,13H2,1H3,(H,19,20)/b15-12+/t16-/m0/s1 |
| InChIKey | AJUXYVLPLLUIJG-STTHAQSSSA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |