methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate

C18H23NO3 — CID 10566210

IUPACmethyl (1E,9S)-9-benzamidocyclononene-1-carboxylate
SMILESCOC(=O)/C1=C/CCCCCC[C@@H]1NC(=O)c1ccccc1
InChIInChI=1S/C18H23NO3/c1-22-18(21)15-12-8-3-2-4-9-13-16(15)19-17(20)14-10-6-5-7-11-14/h5-7,10-12,16H,2-4,8-9,13H2,1H3,(H,19,20)/b15-12+/t16-/m0/s1
InChIKeyAJUXYVLPLLUIJG-STTHAQSSSA-N
MW301.39 g/mol
LogP3.24
Rot. Bonds3

About methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate

methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate (PubChem CID 10566210) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate.

Molecular Properties

Compound Namemethyl (1E,9S)-9-benzamidocyclononene-1-carboxylate
PubChem CID10566210
Molecular FormulaC18H23NO3
Molecular Weight301.39 g/mol
Exact Mass301.17
IUPAC Namemethyl (1E,9S)-9-benzamidocyclononene-1-carboxylate
SMILESCOC(=O)/C1=C/CCCCCC[C@@H]1NC(=O)c1ccccc1
InChIInChI=1S/C18H23NO3/c1-22-18(21)15-12-8-3-2-4-9-13-16(15)19-17(20)14-10-6-5-7-11-14/h5-7,10-12,16H,2-4,8-9,13H2,1H3,(H,19,20)/b15-12+/t16-/m0/s1
InChIKeyAJUXYVLPLLUIJG-STTHAQSSSA-N
XLogP3.24
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.39
LogP ≤ 53.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate?
The IUPAC name of methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate (CID 10566210) is methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate.
What is the SMILES notation for methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate?
The canonical SMILES for methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate is COC(=O)/C1=C/CCCCCC[C@@H]1NC(=O)c1ccccc1.
What is the InChIKey of methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate?
The InChIKey is AJUXYVLPLLUIJG-STTHAQSSSA-N. The full InChI is InChI=1S/C18H23NO3/c1-22-18(21)15-12-8-3-2-4-9-13-16(15)19-17(20)14-10-6-5-7-11-14/h5-7,10-12,16H,2-4,8-9,13H2,1H3,(H,19,20)/b15-12+/t16-/m0/s1.
What are the key properties of methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate?
methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate has a molecular weight of 301.39 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1E,9S)-9-benzamidocyclononene-1-carboxylate is sourced from PubChem (CID 10566210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).