C14H16BrNO2 — CID 102394659
methyl (6S)-6-(2-bromoanilino)cyclohexene-1-carboxylate (PubChem CID 102394659) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is methyl (6S)-6-(2-bromoanilino)cyclohexene-1-carboxylate.
| Compound Name | methyl (6S)-6-(2-bromoanilino)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102394659 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | methyl (6S)-6-(2-bromoanilino)cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CCCC[C@@H]1Nc1ccccc1Br |
| InChI | InChI=1S/C14H16BrNO2/c1-18-14(17)10-6-2-4-8-12(10)16-13-9-5-3-7-11(13)15/h3,5-7,9,12,16H,2,4,8H2,1H3/t12-/m0/s1 |
| InChIKey | FSCVFMSWORFPNZ-LBPRGKRZSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |