C26H17NO7 — CID 102029310
dimethyl 1-(2-oxochromene-3-carbonyl)pyrrolo[1,2-a]quinoline-2,3-dicarboxylate (PubChem CID 102029310) has the molecular formula C26H17NO7 and a molecular weight of 455.42 g/mol. Its IUPAC name is dimethyl 1-(2-oxochromene-3-carbonyl)pyrrolo[1,2-a]quinoline-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-oxochromene-3-carbonyl)pyrrolo[1,2-a]quinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102029310 |
| Molecular Formula | C26H17NO7 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | dimethyl 1-(2-oxochromene-3-carbonyl)pyrrolo[1,2-a]quinoline-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2ccc3ccccc3n2c1C(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C26H17NO7/c1-32-25(30)20-18-12-11-14-7-3-5-9-17(14)27(18)22(21(20)26(31)33-2)23(28)16-13-15-8-4-6-10-19(15)34-24(16)29/h3-13H,1-2H3 |
| InChIKey | JKRKWADVYXOJIR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|