C20H15NO7 — CID 1033949
dimethyl 2-[(2-oxochromene-3-carbonyl)amino]benzene-1,4-dicarboxylate (PubChem CID 1033949) has the molecular formula C20H15NO7 and a molecular weight of 381.34 g/mol. Its IUPAC name is dimethyl 2-[(2-oxochromene-3-carbonyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(2-oxochromene-3-carbonyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 1033949 |
| Molecular Formula | C20H15NO7 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | dimethyl 2-[(2-oxochromene-3-carbonyl)amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C20H15NO7/c1-26-18(23)12-7-8-13(19(24)27-2)15(10-12)21-17(22)14-9-11-5-3-4-6-16(11)28-20(14)25/h3-10H,1-2H3,(H,21,22) |
| InChIKey | UTOUEFUZPLOMCD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|