C24H17N3O2 — CID 170860103
2-amino-1-(11-benzoylpyrrolo[1,2-a][1,10]phenanthrolin-9-yl)ethanone (PubChem CID 170860103) has the molecular formula C24H17N3O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-amino-1-(11-benzoylpyrrolo[1,2-a][1,10]phenanthrolin-9-yl)ethanone.
| Compound Name | 2-amino-1-(11-benzoylpyrrolo[1,2-a][1,10]phenanthrolin-9-yl)ethanone |
|---|---|
| PubChem CID | 170860103 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-amino-1-(11-benzoylpyrrolo[1,2-a][1,10]phenanthrolin-9-yl)ethanone |
| SMILES | NCC(=O)c1cc(C(=O)c2ccccc2)n2c1ccc1ccc3cccnc3c12 |
| InChI | InChI=1S/C24H17N3O2/c25-14-21(28)18-13-20(24(29)17-5-2-1-3-6-17)27-19(18)11-10-16-9-8-15-7-4-12-26-22(15)23(16)27/h1-13H,14,25H2 |
| InChIKey | MOTPHBMXRDCNIE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|