C29H25NO6 — CID 168677969
ethyl 3-(3,4,5-trimethoxybenzoyl)naphtho[2,1-e]indolizine-1-carboxylate (PubChem CID 168677969) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl 3-(3,4,5-trimethoxybenzoyl)naphtho[2,1-e]indolizine-1-carboxylate.
| Compound Name | ethyl 3-(3,4,5-trimethoxybenzoyl)naphtho[2,1-e]indolizine-1-carboxylate |
|---|---|
| PubChem CID | 168677969 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl 3-(3,4,5-trimethoxybenzoyl)naphtho[2,1-e]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)c2cc(OC)c(OC)c(OC)c2)n2c1ccc1c3ccccc3ccc12 |
| InChI | InChI=1S/C29H25NO6/c1-5-36-29(32)21-16-24(27(31)18-14-25(33-2)28(35-4)26(15-18)34-3)30-22-12-10-17-8-6-7-9-19(17)20(22)11-13-23(21)30/h6-16H,5H2,1-4H3 |
| InChIKey | WGXQNRIZGPEMCT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|