C20H21NO4 — CID 71028644
(1,5-dimethylindol-2-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 71028644) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (1,5-dimethylindol-2-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (1,5-dimethylindol-2-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 71028644 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (1,5-dimethylindol-2-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cc3cc(C)ccc3n2C)cc(OC)c1OC |
| InChI | InChI=1S/C20H21NO4/c1-12-6-7-15-13(8-12)9-16(21(15)2)19(22)14-10-17(23-3)20(25-5)18(11-14)24-4/h6-11H,1-5H3 |
| InChIKey | JGSSLBNYMFJTCL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |