C14H16N2O4 — CID 114972609
(2-methylpyrazol-3-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 114972609) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (2-methylpyrazol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 114972609 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (2-methylpyrazol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2ccnn2C)cc(OC)c1OC |
| InChI | InChI=1S/C14H16N2O4/c1-16-10(5-6-15-16)13(17)9-7-11(18-2)14(20-4)12(8-9)19-3/h5-8H,1-4H3 |
| InChIKey | IDQJFVKVCTUCFQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |