C20H19NO5 — CID 71606868
1-methyl-5-(3,4,5-trimethoxybenzoyl)indole-3-carbaldehyde (PubChem CID 71606868) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 1-methyl-5-(3,4,5-trimethoxybenzoyl)indole-3-carbaldehyde.
| Compound Name | 1-methyl-5-(3,4,5-trimethoxybenzoyl)indole-3-carbaldehyde |
|---|---|
| PubChem CID | 71606868 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-methyl-5-(3,4,5-trimethoxybenzoyl)indole-3-carbaldehyde |
| SMILES | COc1cc(C(=O)c2ccc3c(c2)c(C=O)cn3C)cc(OC)c1OC |
| InChI | InChI=1S/C20H19NO5/c1-21-10-14(11-22)15-7-12(5-6-16(15)21)19(23)13-8-17(24-2)20(26-4)18(9-13)25-3/h5-11H,1-4H3 |
| InChIKey | WYVGABPGBUPWKI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|