C21H22N2O6 — CID 137432029
N-hydroxy-3-[5-(3,4,5-trimethoxybenzoyl)indol-1-yl]propanamide (PubChem CID 137432029) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-hydroxy-3-[5-(3,4,5-trimethoxybenzoyl)indol-1-yl]propanamide.
| Compound Name | N-hydroxy-3-[5-(3,4,5-trimethoxybenzoyl)indol-1-yl]propanamide |
|---|---|
| PubChem CID | 137432029 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-hydroxy-3-[5-(3,4,5-trimethoxybenzoyl)indol-1-yl]propanamide |
| SMILES | COc1cc(C(=O)c2ccc3c(ccn3CCC(=O)NO)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N2O6/c1-27-17-11-15(12-18(28-2)21(17)29-3)20(25)14-4-5-16-13(10-14)6-8-23(16)9-7-19(24)22-26/h4-6,8,10-12,26H,7,9H2,1-3H3,(H,22,24) |
| InChIKey | GHKBHTCSNRHXRW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|