C22H20O4 — CID 53364048
(3-phenylphenyl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 53364048) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3-phenylphenyl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (3-phenylphenyl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 53364048 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (3-phenylphenyl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cccc(-c3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20O4/c1-24-19-13-18(14-20(25-2)22(19)26-3)21(23)17-11-7-10-16(12-17)15-8-5-4-6-9-15/h4-14H,1-3H3 |
| InChIKey | ZZSWGUZVEZYACC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |