C73H50O — CID 58299161
[3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-(3,5-diphenylphenyl)methanone (PubChem CID 58299161) has the molecular formula C73H50O and a molecular weight of 943.20 g/mol. Its IUPAC name is [3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-(3,5-diphenylphenyl)methanone.
| Compound Name | [3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-(3,5-diphenylphenyl)methanone |
|---|---|
| PubChem CID | 58299161 |
| Molecular Formula | C73H50O |
| Molecular Weight | 943.20 g/mol |
| Exact Mass | 942.39 |
| IUPAC Name | [3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-(3,5-diphenylphenyl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1cc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)cc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C73H50O/c74-73(71-47-65(55-29-15-5-16-30-55)41-66(48-71)56-31-17-6-18-32-56)72-49-69(59-35-19-33-57(37-59)67-42-61(51-21-7-1-8-22-51)39-62(43-67)52-23-9-2-10-24-52)46-70(50-72)60-36-20-34-58(38-60)68-44-63(53-25-11-3-12-26-53)40-64(45-68)54-27-13-4-14-28-54/h1-50H |
| InChIKey | VJKRPQCXPXKHEG-UHFFFAOYSA-N |
| XLogP | 19.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.20 |
| LogP ≤ 5 | 19.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |