C37H27NO — CID 140587112
(3,5-diphenylphenyl)-[3-[3-(5-methyl-2-pyridinyl)phenyl]phenyl]methanone (PubChem CID 140587112) has the molecular formula C37H27NO and a molecular weight of 501.63 g/mol. Its IUPAC name is (3,5-diphenylphenyl)-[3-[3-(5-methyl-2-pyridinyl)phenyl]phenyl]methanone.
| Compound Name | (3,5-diphenylphenyl)-[3-[3-(5-methyl-2-pyridinyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 140587112 |
| Molecular Formula | C37H27NO |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (3,5-diphenylphenyl)-[3-[3-(5-methyl-2-pyridinyl)phenyl]phenyl]methanone |
| SMILES | Cc1ccc(-c2cccc(-c3cccc(C(=O)c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c3)c2)nc1 |
| InChI | InChI=1S/C37H27NO/c1-26-18-19-36(38-25-26)31-16-8-14-29(20-31)30-15-9-17-32(21-30)37(39)35-23-33(27-10-4-2-5-11-27)22-34(24-35)28-12-6-3-7-13-28/h2-25H,1H3 |
| InChIKey | CWWVSLJDVTWDFN-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |