C97H66O — CID 58299054
bis[3-(3,5-diphenylphenyl)-5-[3-phenyl-5-(3-phenylphenyl)phenyl]phenyl]methanone (PubChem CID 58299054) has the molecular formula C97H66O and a molecular weight of 1247.59 g/mol. Its IUPAC name is bis[3-(3,5-diphenylphenyl)-5-[3-phenyl-5-(3-phenylphenyl)phenyl]phenyl]methanone.
| Compound Name | bis[3-(3,5-diphenylphenyl)-5-[3-phenyl-5-(3-phenylphenyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 58299054 |
| Molecular Formula | C97H66O |
| Molecular Weight | 1247.59 g/mol |
| Exact Mass | 1246.51 |
| IUPAC Name | bis[3-(3,5-diphenylphenyl)-5-[3-phenyl-5-(3-phenylphenyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4ccccc4)c3)c2)c1)c1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C97H66O/c98-97(95-63-91(87-53-79(69-31-13-3-14-32-69)49-80(54-87)70-33-15-4-16-34-70)61-93(65-95)89-57-83(73-39-21-7-22-40-73)51-85(59-89)77-45-25-43-75(47-77)67-27-9-1-10-28-67)96-64-92(88-55-81(71-35-17-5-18-36-71)50-82(56-88)72-37-19-6-20-38-72)62-94(66-96)90-58-84(74-41-23-8-24-42-74)52-86(60-90)78-46-26-44-76(48-78)68-29-11-2-12-30-68/h1-66H |
| InChIKey | RDJXNAKQAUQVHX-UHFFFAOYSA-N |
| XLogP | 26.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1247.59 |
| LogP ≤ 5 | 26.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |