C22H21NO6S — CID 91328901
3,4,5-trimethoxy-N-(3-phenylphenyl)sulfonylbenzamide (PubChem CID 91328901) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(3-phenylphenyl)sulfonylbenzamide.
| Compound Name | 3,4,5-trimethoxy-N-(3-phenylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 91328901 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3,4,5-trimethoxy-N-(3-phenylphenyl)sulfonylbenzamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2cccc(-c3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21NO6S/c1-27-19-13-17(14-20(28-2)21(19)29-3)22(24)23-30(25,26)18-11-7-10-16(12-18)15-8-5-4-6-9-15/h4-14H,1-3H3,(H,23,24) |
| InChIKey | IOPUSTNNDNUMSB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |