C16H13ClN2O5S — CID 75403992
3-chloro-N-(3-cyanophenyl)sulfonyl-4,5-dimethoxybenzamide (PubChem CID 75403992) has the molecular formula C16H13ClN2O5S and a molecular weight of 380.81 g/mol. Its IUPAC name is 3-chloro-N-(3-cyanophenyl)sulfonyl-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-(3-cyanophenyl)sulfonyl-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 75403992 |
| Molecular Formula | C16H13ClN2O5S |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 3-chloro-N-(3-cyanophenyl)sulfonyl-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2cccc(C#N)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C16H13ClN2O5S/c1-23-14-8-11(7-13(17)15(14)24-2)16(20)19-25(21,22)12-5-3-4-10(6-12)9-18/h3-8H,1-2H3,(H,19,20) |
| InChIKey | PJSGLDHBSDLSIA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |