C19H23ClN2O5S — CID 26252009
3-chloro-N-[3-(diethylsulfamoyl)phenyl]-4,5-dimethoxybenzamide (PubChem CID 26252009) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is 3-chloro-N-[3-(diethylsulfamoyl)phenyl]-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-[3-(diethylsulfamoyl)phenyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 26252009 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3-chloro-N-[3-(diethylsulfamoyl)phenyl]-4,5-dimethoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)c2cc(Cl)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C19H23ClN2O5S/c1-5-22(6-2)28(24,25)15-9-7-8-14(12-15)21-19(23)13-10-16(20)18(27-4)17(11-13)26-3/h7-12H,5-6H2,1-4H3,(H,21,23) |
| InChIKey | LFHMPPJOTVWRNE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |