C22H21ClN2O5S — CID 46465633
N-[3-(benzenesulfonamido)-4-methylphenyl]-3-chloro-4,5-dimethoxybenzamide (PubChem CID 46465633) has the molecular formula C22H21ClN2O5S and a molecular weight of 460.94 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-methylphenyl]-3-chloro-4,5-dimethoxybenzamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-3-chloro-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 46465633 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-3-chloro-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C)c(NS(=O)(=O)c3ccccc3)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C22H21ClN2O5S/c1-14-9-10-16(13-19(14)25-31(27,28)17-7-5-4-6-8-17)24-22(26)15-11-18(23)21(30-3)20(12-15)29-2/h4-13,25H,1-3H3,(H,24,26) |
| InChIKey | IJVOUQYLOPYPAE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |