C21H18ClNO4 — CID 4033841
3-chloro-4,5-dimethoxy-N-(4-phenoxyphenyl)benzamide (PubChem CID 4033841) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 4033841 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-(4-phenoxyphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Oc3ccccc3)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H18ClNO4/c1-25-19-13-14(12-18(22)20(19)26-2)21(24)23-15-8-10-17(11-9-15)27-16-6-4-3-5-7-16/h3-13H,1-2H3,(H,23,24) |
| InChIKey | ZIPNNRDHBDTVQY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |