C21H15Cl2N3O4S — CID 35864739
3-cyano-N-[3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxyphenyl]benzamide (PubChem CID 35864739) has the molecular formula C21H15Cl2N3O4S and a molecular weight of 476.34 g/mol. Its IUPAC name is 3-cyano-N-[3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxyphenyl]benzamide.
| Compound Name | 3-cyano-N-[3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 35864739 |
| Molecular Formula | C21H15Cl2N3O4S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 3-cyano-N-[3-[(3,4-dichlorophenyl)sulfonylamino]-4-methoxyphenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(C#N)c2)cc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N3O4S/c1-30-20-8-5-15(25-21(27)14-4-2-3-13(9-14)12-24)10-19(20)26-31(28,29)16-6-7-17(22)18(23)11-16/h2-11,26H,1H3,(H,25,27) |
| InChIKey | GFCQYYSUUHGXKT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |