C22H21ClN4O5S — CID 55521474
3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-N-[4-(methylcarbamoylamino)phenyl]benzamide (PubChem CID 55521474) has the molecular formula C22H21ClN4O5S and a molecular weight of 488.95 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-N-[4-(methylcarbamoylamino)phenyl]benzamide.
| Compound Name | 3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-N-[4-(methylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 55521474 |
| Molecular Formula | C22H21ClN4O5S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 3-[(5-chloro-2-methoxyphenyl)sulfamoyl]-N-[4-(methylcarbamoylamino)phenyl]benzamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)c2cccc(S(=O)(=O)Nc3cc(Cl)ccc3OC)c2)cc1 |
| InChI | InChI=1S/C22H21ClN4O5S/c1-24-22(29)26-17-9-7-16(8-10-17)25-21(28)14-4-3-5-18(12-14)33(30,31)27-19-13-15(23)6-11-20(19)32-2/h3-13,27H,1-2H3,(H,25,28)(H2,24,26,29) |
| InChIKey | WBMFEWBLDFBIMI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |