C20H17N5O3S — CID 2095364
3-cyano-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]benzamide (PubChem CID 2095364) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 3-cyano-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 3-cyano-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2095364 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 3-cyano-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(C#N)c3)cc2)nc(C)n1 |
| InChI | InChI=1S/C20H17N5O3S/c1-13-10-19(23-14(2)22-13)25-29(27,28)18-8-6-17(7-9-18)24-20(26)16-5-3-4-15(11-16)12-21/h3-11H,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | PDSOWFKUGQOTRN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |