C19H19N3O6S — CID 171617358
N-(benzenesulfonyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 171617358) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(benzenesulfonyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 171617358 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-(benzenesulfonyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)NS(=O)(=O)c3ccccc3)[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19N3O6S/c1-26-16-9-12(10-17(27-2)18(16)28-3)14-11-15(21-20-14)19(23)22-29(24,25)13-7-5-4-6-8-13/h4-11H,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | SGHYMTQBXTVYRC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |