C30H28N4O6 — CID 58506935
3,4,5-trimethoxy-N-[[3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamoyl]benzamide (PubChem CID 58506935) has the molecular formula C30H28N4O6 and a molecular weight of 540.58 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamoyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 58506935 |
| Molecular Formula | C30H28N4O6 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[3-[(4-phenylphenyl)carbamoylamino]phenyl]carbamoyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=O)Nc2cccc(NC(=O)Nc3ccc(-c4ccccc4)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H28N4O6/c1-38-25-16-21(17-26(39-2)27(25)40-3)28(35)34-30(37)33-24-11-7-10-23(18-24)32-29(36)31-22-14-12-20(13-15-22)19-8-5-4-6-9-19/h4-18H,1-3H3,(H2,31,32,36)(H2,33,34,35,37) |
| InChIKey | ZIBGOHCSAABMHS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |