C22H24N2O6 — CID 24808168
ethyl 3-amino-6-methyl-2-(3,4,5-trimethoxybenzoyl)indole-1-carboxylate (PubChem CID 24808168) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is ethyl 3-amino-6-methyl-2-(3,4,5-trimethoxybenzoyl)indole-1-carboxylate.
| Compound Name | ethyl 3-amino-6-methyl-2-(3,4,5-trimethoxybenzoyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 24808168 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | ethyl 3-amino-6-methyl-2-(3,4,5-trimethoxybenzoyl)indole-1-carboxylate |
| SMILES | CCOC(=O)n1c(C(=O)c2cc(OC)c(OC)c(OC)c2)c(N)c2ccc(C)cc21 |
| InChI | InChI=1S/C22H24N2O6/c1-6-30-22(26)24-15-9-12(2)7-8-14(15)18(23)19(24)20(25)13-10-16(27-3)21(29-5)17(11-13)28-4/h7-11H,6,23H2,1-5H3 |
| InChIKey | IFANZKREFUSEBY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |