C22H22N2O6 — CID 18368084
ethyl 3-acetamido-2-benzoyl-4,5-dimethoxyindole-1-carboxylate (PubChem CID 18368084) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is ethyl 3-acetamido-2-benzoyl-4,5-dimethoxyindole-1-carboxylate.
| Compound Name | ethyl 3-acetamido-2-benzoyl-4,5-dimethoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 18368084 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | ethyl 3-acetamido-2-benzoyl-4,5-dimethoxyindole-1-carboxylate |
| SMILES | CCOC(=O)n1c(C(=O)c2ccccc2)c(NC(C)=O)c2c(OC)c(OC)ccc21 |
| InChI | InChI=1S/C22H22N2O6/c1-5-30-22(27)24-15-11-12-16(28-3)21(29-4)17(15)18(23-13(2)25)19(24)20(26)14-9-7-6-8-10-14/h6-12H,5H2,1-4H3,(H,23,25) |
| InChIKey | YJOGRBCXEWMYQA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |