C18H22N2O6 — CID 20885069
ethyl 3-acetamido-5,6-dimethoxy-1-(2-oxopropyl)indole-2-carboxylate (PubChem CID 20885069) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is ethyl 3-acetamido-5,6-dimethoxy-1-(2-oxopropyl)indole-2-carboxylate.
| Compound Name | ethyl 3-acetamido-5,6-dimethoxy-1-(2-oxopropyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 20885069 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | ethyl 3-acetamido-5,6-dimethoxy-1-(2-oxopropyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)=O)c2cc(OC)c(OC)cc2n1CC(C)=O |
| InChI | InChI=1S/C18H22N2O6/c1-6-26-18(23)17-16(19-11(3)22)12-7-14(24-4)15(25-5)8-13(12)20(17)9-10(2)21/h7-8H,6,9H2,1-5H3,(H,19,22) |
| InChIKey | MAJLBKREXSOBGM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |