C19H18N2O4 — CID 18367970
N-(2-benzoyl-5,6-dimethoxy-1H-indol-3-yl)acetamide (PubChem CID 18367970) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-(2-benzoyl-5,6-dimethoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-(2-benzoyl-5,6-dimethoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 18367970 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(2-benzoyl-5,6-dimethoxy-1H-indol-3-yl)acetamide |
| SMILES | COc1cc2[nH]c(C(=O)c3ccccc3)c(NC(C)=O)c2cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-11(22)20-17-13-9-15(24-2)16(25-3)10-14(13)21-18(17)19(23)12-7-5-4-6-8-12/h4-10,21H,1-3H3,(H,20,22) |
| InChIKey | WWHMRNXGIVFLNT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |