C20H16BrClN2O4 — CID 118140091
ethyl 2-benzoyl-3-[(2-bromoacetyl)amino]-5-chloroindole-1-carboxylate (PubChem CID 118140091) has the molecular formula C20H16BrClN2O4 and a molecular weight of 463.72 g/mol. Its IUPAC name is ethyl 2-benzoyl-3-[(2-bromoacetyl)amino]-5-chloroindole-1-carboxylate.
| Compound Name | ethyl 2-benzoyl-3-[(2-bromoacetyl)amino]-5-chloroindole-1-carboxylate |
|---|---|
| PubChem CID | 118140091 |
| Molecular Formula | C20H16BrClN2O4 |
| Molecular Weight | 463.72 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | ethyl 2-benzoyl-3-[(2-bromoacetyl)amino]-5-chloroindole-1-carboxylate |
| SMILES | CCOC(=O)n1c(C(=O)c2ccccc2)c(NC(=O)CBr)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H16BrClN2O4/c1-2-28-20(27)24-15-9-8-13(22)10-14(15)17(23-16(25)11-21)18(24)19(26)12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H,23,25) |
| InChIKey | CGJKTCWNBNLCJG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|