C26H33ClN3O6P — CID 118140101
ethyl 5-chloro-3-[(2-diethoxyphosphoryl-3-methylbutyl)amino]-2-(pyridine-3-carbonyl)indole-1-carboxylate (PubChem CID 118140101) has the molecular formula C26H33ClN3O6P and a molecular weight of 549.99 g/mol. Its IUPAC name is ethyl 5-chloro-3-[(2-diethoxyphosphoryl-3-methylbutyl)amino]-2-(pyridine-3-carbonyl)indole-1-carboxylate.
| Compound Name | ethyl 5-chloro-3-[(2-diethoxyphosphoryl-3-methylbutyl)amino]-2-(pyridine-3-carbonyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 118140101 |
| Molecular Formula | C26H33ClN3O6P |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | ethyl 5-chloro-3-[(2-diethoxyphosphoryl-3-methylbutyl)amino]-2-(pyridine-3-carbonyl)indole-1-carboxylate |
| SMILES | CCOC(=O)n1c(C(=O)c2cccnc2)c(NCC(C(C)C)P(=O)(OCC)OCC)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H33ClN3O6P/c1-6-34-26(32)30-21-12-11-19(27)14-20(21)23(24(30)25(31)18-10-9-13-28-15-18)29-16-22(17(4)5)37(33,35-7-2)36-8-3/h9-15,17,22,29H,6-8,16H2,1-5H3 |
| InChIKey | LMUHPPSLBWMOBQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|