C15H13ClN2O3 — CID 1088766
[2-(5-chloro-2-methylanilino)-2-oxoethyl] pyridine-3-carboxylate (PubChem CID 1088766) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl] pyridine-3-carboxylate.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 1088766 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] pyridine-3-carboxylate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COC(=O)c1cccnc1 |
| InChI | InChI=1S/C15H13ClN2O3/c1-10-4-5-12(16)7-13(10)18-14(19)9-21-15(20)11-3-2-6-17-8-11/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | ZRDDSRBBKCQCIO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |