C16H16N2O5 — CID 23915616
[2-(2,4-dimethoxyanilino)-2-oxoethyl] pyridine-3-carboxylate (PubChem CID 23915616) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] pyridine-3-carboxylate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 23915616 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] pyridine-3-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C16H16N2O5/c1-21-12-5-6-13(14(8-12)22-2)18-15(19)10-23-16(20)11-4-3-7-17-9-11/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | SHUZSTRLVBLNQT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |