C17H18N2O3 — CID 39388472
(E)-3-(2,4-dimethoxyanilino)-1-pyridin-3-ylbut-2-en-1-one (PubChem CID 39388472) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyanilino)-1-pyridin-3-ylbut-2-en-1-one.
| Compound Name | (E)-3-(2,4-dimethoxyanilino)-1-pyridin-3-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 39388472 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (E)-3-(2,4-dimethoxyanilino)-1-pyridin-3-ylbut-2-en-1-one |
| SMILES | COc1ccc(N/C(C)=C/C(=O)c2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-12(9-16(20)13-5-4-8-18-11-13)19-15-7-6-14(21-2)10-17(15)22-3/h4-11,19H,1-3H3/b12-9+ |
| InChIKey | JOVIVVBLMPWWJM-FMIVXFBMSA-N |
| XLogP | 3.30 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|