C18H18ClNO3 — CID 799459
1-(4-chlorophenyl)-3-(2,5-dimethoxyanilino)but-2-en-1-one (PubChem CID 799459) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,5-dimethoxyanilino)but-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-(2,5-dimethoxyanilino)but-2-en-1-one |
|---|---|
| PubChem CID | 799459 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,5-dimethoxyanilino)but-2-en-1-one |
| SMILES | COc1ccc(OC)c(NC(C)=CC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H18ClNO3/c1-12(10-17(21)13-4-6-14(19)7-5-13)20-16-11-15(22-2)8-9-18(16)23-3/h4-11,20H,1-3H3 |
| InChIKey | ACPAGQZUBQHUPR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|