C19H17N3O5 — CID 17417789
[2-(2,4-dimethoxyanilino)-2-oxoethyl] quinoxaline-2-carboxylate (PubChem CID 17417789) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] quinoxaline-2-carboxylate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 17417789 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] quinoxaline-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cnc3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C19H17N3O5/c1-25-12-7-8-15(17(9-12)26-2)22-18(23)11-27-19(24)16-10-20-13-5-3-4-6-14(13)21-16/h3-10H,11H2,1-2H3,(H,22,23) |
| InChIKey | AHDGDHDEASTOGN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |