C21H20ClNO2 — CID 154106631
ethyl 5-chloro-1-(cyclopropylmethyl)-3-phenylindole-2-carboxylate (PubChem CID 154106631) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is ethyl 5-chloro-1-(cyclopropylmethyl)-3-phenylindole-2-carboxylate.
| Compound Name | ethyl 5-chloro-1-(cyclopropylmethyl)-3-phenylindole-2-carboxylate |
|---|---|
| PubChem CID | 154106631 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | ethyl 5-chloro-1-(cyclopropylmethyl)-3-phenylindole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c2cc(Cl)ccc2n1CC1CC1 |
| InChI | InChI=1S/C21H20ClNO2/c1-2-25-21(24)20-19(15-6-4-3-5-7-15)17-12-16(22)10-11-18(17)23(20)13-14-8-9-14/h3-7,10-12,14H,2,8-9,13H2,1H3 |
| InChIKey | JMWSFMSTZWHBCS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |