C22H21Cl2FN2O2 — CID 130340735
ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-(3-chlorophenyl)-2-methylindole-5-carboxylate (PubChem CID 130340735) has the molecular formula C22H21Cl2FN2O2 and a molecular weight of 435.33 g/mol. Its IUPAC name is ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-(3-chlorophenyl)-2-methylindole-5-carboxylate.
| Compound Name | ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-(3-chlorophenyl)-2-methylindole-5-carboxylate |
|---|---|
| PubChem CID | 130340735 |
| Molecular Formula | C22H21Cl2FN2O2 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-(3-chlorophenyl)-2-methylindole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c(-c1cccc(Cl)c1)c(C)n2C/C(F)=C/CNCl |
| InChI | InChI=1S/C22H21Cl2FN2O2/c1-3-29-22(28)16-7-8-20-19(12-16)21(15-5-4-6-17(23)11-15)14(2)27(20)13-18(25)9-10-26-24/h4-9,11-12,26H,3,10,13H2,1-2H3/b18-9- |
| InChIKey | YKKOAOZCQUJZGT-NVMNQCDNSA-N |
| XLogP | 6.04 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|