C24H26ClFN2O2 — CID 130341331
3-(3-tert-butylphenyl)-1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-2-methylindole-5-carboxylic acid (PubChem CID 130341331) has the molecular formula C24H26ClFN2O2 and a molecular weight of 428.94 g/mol. Its IUPAC name is 3-(3-tert-butylphenyl)-1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-2-methylindole-5-carboxylic acid.
| Compound Name | 3-(3-tert-butylphenyl)-1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-2-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 130341331 |
| Molecular Formula | C24H26ClFN2O2 |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 3-(3-tert-butylphenyl)-1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-2-methylindole-5-carboxylic acid |
| SMILES | Cc1c(-c2cccc(C(C)(C)C)c2)c2cc(C(=O)O)ccc2n1C/C(F)=C/CNCl |
| InChI | InChI=1S/C24H26ClFN2O2/c1-15-22(16-6-5-7-18(12-16)24(2,3)4)20-13-17(23(29)30)8-9-21(20)28(15)14-19(26)10-11-27-25/h5-10,12-13,27H,11,14H2,1-4H3,(H,29,30)/b19-10- |
| InChIKey | ITMPVGDYYRCUOI-GRSHGNNSSA-N |
| XLogP | 6.21 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|