C23H25ClFN3O4S — CID 130341102
methyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate (PubChem CID 130341102) has the molecular formula C23H25ClFN3O4S and a molecular weight of 493.99 g/mol. Its IUPAC name is methyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate.
| Compound Name | methyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate |
|---|---|
| PubChem CID | 130341102 |
| Molecular Formula | C23H25ClFN3O4S |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | methyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(-c1cccc(S(=O)(=O)N(C)C)c1)c(C)n2C/C(F)=C/CNCl |
| InChI | InChI=1S/C23H25ClFN3O4S/c1-15-22(16-6-5-7-19(12-16)33(30,31)27(2)3)20-13-17(23(29)32-4)8-9-21(20)28(15)14-18(25)10-11-26-24/h5-10,12-13,26H,11,14H2,1-4H3/b18-10- |
| InChIKey | WYUSDLGODHIVQD-ZDLGFXPLSA-N |
| XLogP | 4.25 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|