C24H30ClFN4O4S2 — CID 130335711
1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide (PubChem CID 130335711) has the molecular formula C24H30ClFN4O4S2 and a molecular weight of 557.11 g/mol. Its IUPAC name is 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide.
| Compound Name | 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide |
|---|---|
| PubChem CID | 130335711 |
| Molecular Formula | C24H30ClFN4O4S2 |
| Molecular Weight | 557.11 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide |
| SMILES | Cc1c(Cc2ccc(S(=O)(=O)N(C)C)cc2)c2cc(S(=O)(=O)N(C)C)ccc2n1C/C(F)=C/CNCl |
| InChI | InChI=1S/C24H30ClFN4O4S2/c1-17-22(14-18-6-8-20(9-7-18)35(31,32)28(2)3)23-15-21(36(33,34)29(4)5)10-11-24(23)30(17)16-19(26)12-13-27-25/h6-12,15,27H,13-14,16H2,1-5H3/b19-12- |
| InChIKey | DROOMLQRXDUYIR-UNOMPAQXSA-N |
| XLogP | 3.64 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|