C23H26FN3O4S — CID 130335759
1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxylic acid (PubChem CID 130335759) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxylic acid.
| Compound Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 130335759 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxylic acid |
| SMILES | Cc1c(Cc2ccc(S(=O)(=O)N(C)C)cc2)c2cc(C(=O)O)ccc2n1C/C(F)=C/CN |
| InChI | InChI=1S/C23H26FN3O4S/c1-15-20(12-16-4-7-19(8-5-16)32(30,31)26(2)3)21-13-17(23(28)29)6-9-22(21)27(15)14-18(24)10-11-25/h4-10,13H,11-12,14,25H2,1-3H3,(H,28,29)/b18-10- |
| InChIKey | UFVLHUTZCSGQSG-ZDLGFXPLSA-N |
| XLogP | 3.30 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|