C23H28ClFN4O3S — CID 138558613
1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxamide;hydrochloride (PubChem CID 138558613) has the molecular formula C23H28ClFN4O3S and a molecular weight of 495.02 g/mol. Its IUPAC name is 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxamide;hydrochloride.
| Compound Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 138558613 |
| Molecular Formula | C23H28ClFN4O3S |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-2-methylindole-5-carboxamide;hydrochloride |
| SMILES | Cc1c(Cc2ccc(S(=O)(=O)N(C)C)cc2)c2cc(C(N)=O)ccc2n1C/C(F)=C/CN.Cl |
| InChI | InChI=1S/C23H27FN4O3S.ClH/c1-15-20(12-16-4-7-19(8-5-16)32(30,31)27(2)3)21-13-17(23(26)29)6-9-22(21)28(15)14-18(24)10-11-25;/h4-10,13H,11-12,14,25H2,1-3H3,(H2,26,29);1H/b18-10-; |
| InChIKey | AYVQNOGNQIFFOB-LFYAFSDUSA-N |
| XLogP | 3.12 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|