C24H29FN4O3S — CID 130335655
1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N-dimethylindole-2-carboxamide (PubChem CID 130335655) has the molecular formula C24H29FN4O3S and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N-dimethylindole-2-carboxamide.
| Compound Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N-dimethylindole-2-carboxamide |
|---|---|
| PubChem CID | 130335655 |
| Molecular Formula | C24H29FN4O3S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]-N,N-dimethylindole-2-carboxamide |
| SMILES | CN(C)C(=O)c1c(Cc2ccc(S(=O)(=O)N(C)C)cc2)c2ccccc2n1C/C(F)=C/CN |
| InChI | InChI=1S/C24H29FN4O3S/c1-27(2)24(30)23-21(15-17-9-11-19(12-10-17)33(31,32)28(3)4)20-7-5-6-8-22(20)29(23)16-18(25)13-14-26/h5-13H,14-16,26H2,1-4H3/b18-13- |
| InChIKey | BGDMXNVSBAZIDX-AQTBWJFISA-N |
| XLogP | 3.00 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|