C24H27ClFN3O4S — CID 130340745
ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate (PubChem CID 130340745) has the molecular formula C24H27ClFN3O4S and a molecular weight of 508.02 g/mol. Its IUPAC name is ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate.
| Compound Name | ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate |
|---|---|
| PubChem CID | 130340745 |
| Molecular Formula | C24H27ClFN3O4S |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | ethyl 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c(-c1cccc(S(=O)(=O)N(C)C)c1)c(C)n2C/C(F)=C/CNCl |
| InChI | InChI=1S/C24H27ClFN3O4S/c1-5-33-24(30)18-9-10-22-21(14-18)23(16(2)29(22)15-19(26)11-12-27-25)17-7-6-8-20(13-17)34(31,32)28(3)4/h6-11,13-14,27H,5,12,15H2,1-4H3/b19-11- |
| InChIKey | QGLJKADLTGVHAO-ODLFYWEKSA-N |
| XLogP | 4.64 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|