C22H25ClFN3O3S — CID 130340942
3-[1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-5-methoxy-2-methylindol-3-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 130340942) has the molecular formula C22H25ClFN3O3S and a molecular weight of 465.98 g/mol. Its IUPAC name is 3-[1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-5-methoxy-2-methylindol-3-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-5-methoxy-2-methylindol-3-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 130340942 |
| Molecular Formula | C22H25ClFN3O3S |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 3-[1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-5-methoxy-2-methylindol-3-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc2c(c1)c(-c1cccc(S(=O)(=O)N(C)C)c1)c(C)n2C/C(F)=C/CNCl |
| InChI | InChI=1S/C22H25ClFN3O3S/c1-15-22(16-6-5-7-19(12-16)31(28,29)26(2)3)20-13-18(30-4)8-9-21(20)27(15)14-17(24)10-11-25-23/h5-10,12-13,25H,11,14H2,1-4H3/b17-10- |
| InChIKey | REILVVFPBCZMBO-YVLHZVERSA-N |
| XLogP | 4.47 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|