C24H26FN3O2 — CID 145350122
3-[1-[(Z)-4-amino-2-fluorobut-2-enyl]-5-(1-hydroxyethenyl)-2-methylindol-3-yl]-N,N-dimethylbenzamide (PubChem CID 145350122) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-[1-[(Z)-4-amino-2-fluorobut-2-enyl]-5-(1-hydroxyethenyl)-2-methylindol-3-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[1-[(Z)-4-amino-2-fluorobut-2-enyl]-5-(1-hydroxyethenyl)-2-methylindol-3-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 145350122 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 3-[1-[(Z)-4-amino-2-fluorobut-2-enyl]-5-(1-hydroxyethenyl)-2-methylindol-3-yl]-N,N-dimethylbenzamide |
| SMILES | C=C(O)c1ccc2c(c1)c(-c1cccc(C(=O)N(C)C)c1)c(C)n2C/C(F)=C/CN |
| InChI | InChI=1S/C24H26FN3O2/c1-15-23(18-6-5-7-19(12-18)24(30)27(3)4)21-13-17(16(2)29)8-9-22(21)28(15)14-20(25)10-11-26/h5-10,12-13,29H,2,11,14,26H2,1,3-4H3/b20-10- |
| InChIKey | QQZHBFQITNTYCL-JMIUGGIZSA-N |
| XLogP | 4.66 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|