C23H26FN3O2S — CID 145350168
1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-methylindole-5-carboxylic acid (PubChem CID 145350168) has the molecular formula C23H26FN3O2S and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-methylindole-5-carboxylic acid.
| Compound Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 145350168 |
| Molecular Formula | C23H26FN3O2S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-methylindole-5-carboxylic acid |
| SMILES | Cc1ccc(SN(C)C)cc1-c1c(C)n(C/C(F)=C/CN)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C23H26FN3O2S/c1-14-5-7-18(30-26(3)4)12-19(14)22-15(2)27(13-17(24)9-10-25)21-8-6-16(23(28)29)11-20(21)22/h5-9,11-12H,10,13,25H2,1-4H3,(H,28,29)/b17-9- |
| InChIKey | DIOWRAWKVSDVFW-MFOYZWKCSA-N |
| XLogP | 5.00 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|